| Name | cis-3-hexenyl benzoate |
| Synonyms | FEMA 3688 C3 HEXENYL BENZOATE CIS-3-HEXENYL BENZOATE cis-3-hexenyl benzoate HEXENYL-CIS-3-BENZOATE CIS 3 HEXENYL BENZOATE HEXENYL BENZOATE, CIS-3- CIS-3-HEXEN-1-YL BENZOATE Benzoicacidcishexenylester (3Z)-hex-3-en-1-yl benzoate BENZOIC ACID CIS-3-HEXEN-1-YL ESTER Benzoic acid cis-3-Hexen-1-yl ester |
| CAS | 25152-85-6 |
| EINECS | 246-669-4 |
| InChI | InChI=1/C13H16O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h3-7,9-10H,2,8,11H2,1H3/b4-3- |
| Molecular Formula | C13H16O2 |
| Molar Mass | 204.26 |
| Density | 0.999g/mLat 25°C(lit.) |
| Boling Point | 105°C1mm Hg(lit.) |
| Flash Point | >230°F |
| JECFA Number | 858 |
| Water Solubility | 40.3mg/L at 24℃ |
| Vapor Presure | 0.45Pa at 24℃ |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.508(lit.) |
| MDL | MFCD00036526 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| RTECS | DH1442500 |
| HS Code | 29163100 |
| FEMA | 3688 | CIS-3-HEXENYL BENZOATE |
| LogP | 4.5 at 25℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxicity | GRAS(FEMA). |
| usage limit | FEMA(mg/kg): baked goods, hard candy, 3.0; Soft candy, gel, pudding, alcohol-free beverage, dairy product, sugar and icing, jam, jelly, sweet sauce, 1.0; Alcohol-containing beverage 2.0; Gum sugar 10.0. |
| Production method | Leaf alcohol and benzoyl chloride are esterified in the presence of a basic catalyst. |